C12H12ClNO5 — CID 61152009
(2S)-2-[(3-chlorobenzoyl)amino]pentanedioic acid (PubChem CID 61152009) has the molecular formula C12H12ClNO5 and a molecular weight of 285.68 g/mol. Its IUPAC name is (2S)-2-[(3-chlorobenzoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(3-chlorobenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 61152009 |
| Molecular Formula | C12H12ClNO5 |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | (2S)-2-[(3-chlorobenzoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H12ClNO5/c13-8-3-1-2-7(6-8)11(17)14-9(12(18)19)4-5-10(15)16/h1-3,6,9H,4-5H2,(H,14,17)(H,15,16)(H,18,19)/t9-/m0/s1 |
| InChIKey | TUUBBWPXOYFQDM-VIFPVBQESA-N |
| XLogP | 1.39 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |