C13H15ClN2O5 — CID 61244023
2-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 61244023) has the molecular formula C13H15ClN2O5 and a molecular weight of 314.72 g/mol. Its IUPAC name is 2-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61244023 |
| Molecular Formula | C13H15ClN2O5 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)NC(CCO)C(=O)O |
| InChI | InChI=1S/C13H15ClN2O5/c14-9-3-1-2-8(6-9)12(19)15-7-11(18)16-10(4-5-17)13(20)21/h1-3,6,10,17H,4-5,7H2,(H,15,19)(H,16,18)(H,20,21) |
| InChIKey | AFVSLJDJOQTMLM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |