C14H19ClN2O4 — CID 103802920
3-chloro-N-[2-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-oxoethyl]benzamide (PubChem CID 103802920) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 3-chloro-N-[2-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 103802920 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-chloro-N-[2-[(4-hydroxy-1-methoxybutan-2-yl)amino]-2-oxoethyl]benzamide |
| SMILES | COCC(CCO)NC(=O)CNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O4/c1-21-9-12(5-6-18)17-13(19)8-16-14(20)10-3-2-4-11(15)7-10/h2-4,7,12,18H,5-6,8-9H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | ZEILKPULFVMKEO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |