C14H20BClN2O4 — CID 25183871
[(1R)-1-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid (PubChem CID 25183871) has the molecular formula C14H20BClN2O4 and a molecular weight of 326.59 g/mol. Its IUPAC name is [(1R)-1-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 25183871 |
| Molecular Formula | C14H20BClN2O4 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(1R)-1-[[2-[(3-chlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cccc(Cl)c1)B(O)O |
| InChI | InChI=1S/C14H20BClN2O4/c1-9(2)6-12(15(21)22)18-13(19)8-17-14(20)10-4-3-5-11(16)7-10/h3-5,7,9,12,21-22H,6,8H2,1-2H3,(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | OVCJMQZLNSDDIL-LBPRGKRZSA-N |
| XLogP | 0.61 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|