C14H18BBrCl2N2O4 — CID 145402563
[(1R)-1-[[2-[(6-bromo-2,3-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid (PubChem CID 145402563) has the molecular formula C14H18BBrCl2N2O4 and a molecular weight of 439.93 g/mol. Its IUPAC name is [(1R)-1-[[2-[(6-bromo-2,3-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[2-[(6-bromo-2,3-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 145402563 |
| Molecular Formula | C14H18BBrCl2N2O4 |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | [(1R)-1-[[2-[(6-bromo-2,3-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1c(Br)ccc(Cl)c1Cl)B(O)O |
| InChI | InChI=1S/C14H18BBrCl2N2O4/c1-7(2)5-10(15(23)24)20-11(21)6-19-14(22)12-8(16)3-4-9(17)13(12)18/h3-4,7,10,23-24H,5-6H2,1-2H3,(H,19,22)(H,20,21)/t10-/m0/s1 |
| InChIKey | NBVPVTRKTLHGDQ-JTQLQIEISA-N |
| XLogP | 2.03 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|