C19H27BBrCl2N3O4 — CID 145402753
3-bromo-2,6-dichloro-N-[2-[[(1R)-3-methyl-1-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)butyl]amino]-2-oxoethyl]benzamide (PubChem CID 145402753) has the molecular formula C19H27BBrCl2N3O4 and a molecular weight of 523.06 g/mol. Its IUPAC name is 3-bromo-2,6-dichloro-N-[2-[[(1R)-3-methyl-1-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)butyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-2,6-dichloro-N-[2-[[(1R)-3-methyl-1-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)butyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 145402753 |
| Molecular Formula | C19H27BBrCl2N3O4 |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 3-bromo-2,6-dichloro-N-[2-[[(1R)-3-methyl-1-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)butyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1c(Cl)ccc(Br)c1Cl)B1OCCN(C)CCO1 |
| InChI | InChI=1S/C19H27BBrCl2N3O4/c1-12(2)10-15(20-29-8-6-26(3)7-9-30-20)25-16(27)11-24-19(28)17-14(22)5-4-13(21)18(17)23/h4-5,12,15H,6-11H2,1-3H3,(H,24,28)(H,25,27)/t15-/m0/s1 |
| InChIKey | HRRAZUHQGIRZEK-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|