C20H25BCl2N2O7 — CID 140759178
2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide (PubChem CID 140759178) has the molecular formula C20H25BCl2N2O7 and a molecular weight of 487.15 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 140759178 |
| Molecular Formula | C20H25BCl2N2O7 |
| Molecular Weight | 487.15 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4,8-dioxo-1,3,6,2-trioxaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(=O)[C@H](C)O[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C20H25BCl2N2O7/c1-10(2)7-16(21-31-19(28)11(3)30-12(4)20(29)32-21)25-17(26)9-24-18(27)14-8-13(22)5-6-15(14)23/h5-6,8,10-12,16H,7,9H2,1-4H3,(H,24,27)(H,25,26)/t11-,12+,16-/m0/s1 |
| InChIKey | DPXIHFNNLAMRHH-OZVIIMIRSA-N |
| XLogP | 2.18 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|