C14H17BCl2N2O2 — CID 123415418
CID 123415418 (PubChem CID 123415418) has the molecular formula C14H17BCl2N2O2 and a molecular weight of 327.02 g/mol.
| Compound Name | CID 123415418 |
|---|---|
| PubChem CID | 123415418 |
| Molecular Formula | C14H17BCl2N2O2 |
| Molecular Weight | 327.02 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | — |
| SMILES | [B]C(CC(C)C)NC(=O)CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H17BCl2N2O2/c1-8(2)5-12(15)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/h3-4,6,8,12H,5,7H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | CDFSNHZUTLZCTK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.02 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|