C22H23BCl2N2O5 — CID 69035657
2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(5R)-4-oxo-5-phenyl-1,3,2-dioxaborolan-2-yl]butyl]amino]-2-oxoethyl]benzamide (PubChem CID 69035657) has the molecular formula C22H23BCl2N2O5 and a molecular weight of 477.15 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(5R)-4-oxo-5-phenyl-1,3,2-dioxaborolan-2-yl]butyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(5R)-4-oxo-5-phenyl-1,3,2-dioxaborolan-2-yl]butyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 69035657 |
| Molecular Formula | C22H23BCl2N2O5 |
| Molecular Weight | 477.15 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(5R)-4-oxo-5-phenyl-1,3,2-dioxaborolan-2-yl]butyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(=O)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C22H23BCl2N2O5/c1-13(2)10-18(23-31-20(22(30)32-23)14-6-4-3-5-7-14)27-19(28)12-26-21(29)16-11-15(24)8-9-17(16)25/h3-9,11,13,18,20H,10,12H2,1-2H3,(H,26,29)(H,27,28)/t18-,20+/m0/s1 |
| InChIKey | HJGITRHEDDSDEL-AZUAARDMSA-N |
| XLogP | 3.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|