C22H35BCl2N2O3 — CID 142533840
2,5-dichloro-N-[2-[[(1R)-3-methyl-1-(3,3,4,4-tetramethyloxaboretan-2-yl)butyl]amino]-2-oxoethyl]benzamide;ethane (PubChem CID 142533840) has the molecular formula C22H35BCl2N2O3 and a molecular weight of 457.25 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-(3,3,4,4-tetramethyloxaboretan-2-yl)butyl]amino]-2-oxoethyl]benzamide;ethane.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-(3,3,4,4-tetramethyloxaboretan-2-yl)butyl]amino]-2-oxoethyl]benzamide;ethane |
|---|---|
| PubChem CID | 142533840 |
| Molecular Formula | C22H35BCl2N2O3 |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-(3,3,4,4-tetramethyloxaboretan-2-yl)butyl]amino]-2-oxoethyl]benzamide;ethane |
| SMILES | CC.CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(C)(C)C1(C)C |
| InChI | InChI=1S/C20H29BCl2N2O3.C2H6/c1-12(2)9-16(21-19(3,4)20(5,6)28-21)25-17(26)11-24-18(27)14-10-13(22)7-8-15(14)23;1-2/h7-8,10,12,16H,9,11H2,1-6H3,(H,24,27)(H,25,26);1-2H3/t16-;/m0./s1 |
| InChIKey | RTYDNWZXFZNFOQ-NTISSMGPSA-N |
| XLogP | 5.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|