C28H44BCl2N5O8 — CID 155643177
N-[2-[[(1R)-1-[4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]-2,5-dichlorobenzamide (PubChem CID 155643177) has the molecular formula C28H44BCl2N5O8 and a molecular weight of 660.41 g/mol. Its IUPAC name is N-[2-[[(1R)-1-[4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]-2,5-dichlorobenzamide.
| Compound Name | N-[2-[[(1R)-1-[4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 155643177 |
| Molecular Formula | C28H44BCl2N5O8 |
| Molecular Weight | 660.41 g/mol |
| Exact Mass | 659.27 |
| IUPAC Name | N-[2-[[(1R)-1-[4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]-2,5-dichlorobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(C)(C)C(C)(COCCOCCOCCOCCN=[N+]=[N-])O1 |
| InChI | InChI=1S/C28H44BCl2N5O8/c1-20(2)16-24(35-25(37)18-33-26(38)22-17-21(30)6-7-23(22)31)29-43-27(3,4)28(5,44-29)19-42-15-14-41-13-12-40-11-10-39-9-8-34-36-32/h6-7,17,20,24H,8-16,18-19H2,1-5H3,(H,33,38)(H,35,37)/t24-,28?/m0/s1 |
| InChIKey | WOHHORKNKSGZFH-ZZDYIDRTSA-N |
| XLogP | 4.24 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|