C16H23BCl2N2O2 — CID 59441524
2,5-dichloro-N-[2-[[(1R)-1-dimethylboranyl-3-methylbutyl]amino]-2-oxoethyl]benzamide (PubChem CID 59441524) has the molecular formula C16H23BCl2N2O2 and a molecular weight of 357.09 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-1-dimethylboranyl-3-methylbutyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-1-dimethylboranyl-3-methylbutyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 59441524 |
| Molecular Formula | C16H23BCl2N2O2 |
| Molecular Weight | 357.09 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-1-dimethylboranyl-3-methylbutyl]amino]-2-oxoethyl]benzamide |
| SMILES | CB(C)[C@H](CC(C)C)NC(=O)CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H23BCl2N2O2/c1-10(2)7-14(17(3)4)21-15(22)9-20-16(23)12-8-11(18)5-6-13(12)19/h5-6,8,10,14H,7,9H2,1-4H3,(H,20,23)(H,21,22)/t14-/m0/s1 |
| InChIKey | LRBXBSFOFPRCLS-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|