C15H18Cl2N2O4 — CID 91795654
3-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 91795654) has the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.23 g/mol. Its IUPAC name is 3-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 3-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 91795654 |
| Molecular Formula | C15H18Cl2N2O4 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)NC(=O)CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O4/c1-8(2)12(6-14(21)22)19-13(20)7-18-15(23)10-5-9(16)3-4-11(10)17/h3-5,8,12H,6-7H2,1-2H3,(H,18,23)(H,19,20)(H,21,22) |
| InChIKey | WOCVEKWWJJIUDC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |