C16H16Cl2N4O2 — CID 91782726
2,5-dichloro-N-[2-oxo-2-(1-pyrazin-2-ylpropan-2-ylamino)ethyl]benzamide (PubChem CID 91782726) has the molecular formula C16H16Cl2N4O2 and a molecular weight of 367.24 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-oxo-2-(1-pyrazin-2-ylpropan-2-ylamino)ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-oxo-2-(1-pyrazin-2-ylpropan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 91782726 |
| Molecular Formula | C16H16Cl2N4O2 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2,5-dichloro-N-[2-oxo-2-(1-pyrazin-2-ylpropan-2-ylamino)ethyl]benzamide |
| SMILES | CC(Cc1cnccn1)NC(=O)CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H16Cl2N4O2/c1-10(6-12-8-19-4-5-20-12)22-15(23)9-21-16(24)13-7-11(17)2-3-14(13)18/h2-5,7-8,10H,6,9H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | PUFNDRBLTXCPPD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |