C17H17ClN6O — CID 45200047
1-[(3-chlorophenyl)methyl]-N-(1-pyrazin-2-ylpropan-2-yl)triazole-4-carboxamide (PubChem CID 45200047) has the molecular formula C17H17ClN6O and a molecular weight of 356.82 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-(1-pyrazin-2-ylpropan-2-yl)triazole-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-(1-pyrazin-2-ylpropan-2-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 45200047 |
| Molecular Formula | C17H17ClN6O |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-(1-pyrazin-2-ylpropan-2-yl)triazole-4-carboxamide |
| SMILES | CC(Cc1cnccn1)NC(=O)c1cn(Cc2cccc(Cl)c2)nn1 |
| InChI | InChI=1S/C17H17ClN6O/c1-12(7-15-9-19-5-6-20-15)21-17(25)16-11-24(23-22-16)10-13-3-2-4-14(18)8-13/h2-6,8-9,11-12H,7,10H2,1H3,(H,21,25) |
| InChIKey | TZUKHGXSRUCOTQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |