C10H11BCl2N2O4 — CID 142284164
[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]methylboronic acid (PubChem CID 142284164) has the molecular formula C10H11BCl2N2O4 and a molecular weight of 304.93 g/mol. Its IUPAC name is [[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]methylboronic acid.
| Compound Name | [[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 142284164 |
| Molecular Formula | C10H11BCl2N2O4 |
| Molecular Weight | 304.93 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | [[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]methylboronic acid |
| SMILES | O=C(CNC(=O)c1cc(Cl)ccc1Cl)NCB(O)O |
| InChI | InChI=1S/C10H11BCl2N2O4/c12-6-1-2-8(13)7(3-6)10(17)14-4-9(16)15-5-11(18)19/h1-3,18-19H,4-5H2,(H,14,17)(H,15,16) |
| InChIKey | LJEWHUKMHXGFSN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.93 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|