C13H14Cl2N2O2 — CID 70640697
2,5-dichloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 70640697) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2,5-dichloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 70640697 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2,5-dichloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O2/c14-9-3-4-11(15)10(7-9)13(19)16-8-12(18)17-5-1-2-6-17/h3-4,7H,1-2,5-6,8H2,(H,16,19) |
| InChIKey | YXMLEUPPPLVLGP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |