C13H16ClN3O2 — CID 112687673
3-amino-4-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 112687673) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 3-amino-4-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 3-amino-4-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 112687673 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-amino-4-chloro-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | Nc1cc(C(=O)NCC(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C13H16ClN3O2/c14-10-4-3-9(7-11(10)15)13(19)16-8-12(18)17-5-1-2-6-17/h3-4,7H,1-2,5-6,8,15H2,(H,16,19) |
| InChIKey | VAKPUYALMWNJEN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|