C14H17ClN2O2 — CID 113405963
4-(chloromethyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 113405963) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 4-(chloromethyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 113405963 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-(chloromethyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCCC1)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C14H17ClN2O2/c15-9-11-3-5-12(6-4-11)14(19)16-10-13(18)17-7-1-2-8-17/h3-6H,1-2,7-10H2,(H,16,19) |
| InChIKey | PDANHJXHQKOONK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|