C14H16Br2N2O2 — CID 103908567
3,5-dibromo-N-(2-oxo-2-piperidin-1-ylethyl)benzamide (PubChem CID 103908567) has the molecular formula C14H16Br2N2O2 and a molecular weight of 404.10 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-oxo-2-piperidin-1-ylethyl)benzamide.
| Compound Name | 3,5-dibromo-N-(2-oxo-2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 103908567 |
| Molecular Formula | C14H16Br2N2O2 |
| Molecular Weight | 404.10 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 3,5-dibromo-N-(2-oxo-2-piperidin-1-ylethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCCCC1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H16Br2N2O2/c15-11-6-10(7-12(16)8-11)14(20)17-9-13(19)18-4-2-1-3-5-18/h6-8H,1-5,9H2,(H,17,20) |
| InChIKey | GGRNNSVOAVFVIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |