C14H16Cl2N2O2S — CID 86846006
3,4-dichloro-N-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]benzamide (PubChem CID 86846006) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 86846006 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3,4-dichloro-N-[2-oxo-2-(1,4-thiazepan-4-yl)ethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCCSCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c15-11-3-2-10(8-12(11)16)14(20)17-9-13(19)18-4-1-6-21-7-5-18/h2-3,8H,1,4-7,9H2,(H,17,20) |
| InChIKey | OKYRGCFBGMMZPE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |