C21H22Cl2N4O3 — CID 34432708
N-[2-[4-(2-anilino-2-oxoethyl)piperazin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide (PubChem CID 34432708) has the molecular formula C21H22Cl2N4O3 and a molecular weight of 449.34 g/mol. Its IUPAC name is N-[2-[4-(2-anilino-2-oxoethyl)piperazin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[4-(2-anilino-2-oxoethyl)piperazin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 34432708 |
| Molecular Formula | C21H22Cl2N4O3 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[2-[4-(2-anilino-2-oxoethyl)piperazin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide |
| SMILES | O=C(CN1CCN(C(=O)CNC(=O)c2ccc(Cl)c(Cl)c2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C21H22Cl2N4O3/c22-17-7-6-15(12-18(17)23)21(30)24-13-20(29)27-10-8-26(9-11-27)14-19(28)25-16-4-2-1-3-5-16/h1-7,12H,8-11,13-14H2,(H,24,30)(H,25,28) |
| InChIKey | QHASHOGBPKFWHJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |