C20H21Cl2N3O3 — CID 27665451
3,4-dichloro-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzamide (PubChem CID 27665451) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 27665451 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 3,4-dichloro-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzamide |
| SMILES | COc1ccccc1N1CCN(C(=O)CNC(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H21Cl2N3O3/c1-28-18-5-3-2-4-17(18)24-8-10-25(11-9-24)19(26)13-23-20(27)14-6-7-15(21)16(22)12-14/h2-7,12H,8-11,13H2,1H3,(H,23,27) |
| InChIKey | QDRVFXOVJCVKTE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |