C19H19Cl3N2O3 — CID 2204350
1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 2204350) has the molecular formula C19H19Cl3N2O3 and a molecular weight of 429.73 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 2204350 |
| Molecular Formula | C19H19Cl3N2O3 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | COc1ccccc1N1CCN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H19Cl3N2O3/c1-26-17-5-3-2-4-16(17)23-6-8-24(9-7-23)19(25)12-27-18-11-14(21)13(20)10-15(18)22/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | ADRNAAYAILZFOQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|