C18H17Cl3N2O2 — CID 9013636
1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone (PubChem CID 9013636) has the molecular formula C18H17Cl3N2O2 and a molecular weight of 399.71 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone.
| Compound Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 9013636 |
| Molecular Formula | C18H17Cl3N2O2 |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H17Cl3N2O2/c19-13-5-6-17(15(21)11-13)25-12-18(24)23-9-7-22(8-10-23)16-4-2-1-3-14(16)20/h1-6,11H,7-10,12H2 |
| InChIKey | IQBUAUIRQDDVRQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |