C15H18Cl2N2O3S — CID 71819731
1-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one (PubChem CID 71819731) has the molecular formula C15H18Cl2N2O3S and a molecular weight of 377.29 g/mol. Its IUPAC name is 1-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one.
| Compound Name | 1-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 71819731 |
| Molecular Formula | C15H18Cl2N2O3S |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-3-sulfanylpropan-1-one |
| SMILES | O=C(CCS)N1CCN(C(=O)COc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H18Cl2N2O3S/c16-11-1-2-13(12(17)9-11)22-10-15(21)19-6-4-18(5-7-19)14(20)3-8-23/h1-2,9,23H,3-8,10H2 |
| InChIKey | NCHHIVFOOSHLBD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|