C19H18Cl2N2O5 — CID 108536095
2-(2,4-dichlorophenoxy)-1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]ethanone (PubChem CID 108536095) has the molecular formula C19H18Cl2N2O5 and a molecular weight of 425.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108536095 |
| Molecular Formula | C19H18Cl2N2O5 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C19H18Cl2N2O5/c20-13-1-2-17(16(21)9-13)28-11-18(26)22-3-5-23(6-4-22)19(27)12-7-14(24)10-15(25)8-12/h1-2,7-10,24-25H,3-6,11H2 |
| InChIKey | AAMSZDLCWPQYFS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |