C21H22Cl2N2O3 — CID 108536090
2-(2,4-dichlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 108536090) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108536090 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)COc3ccc(Cl)cc3Cl)CC2)cc1C |
| InChI | InChI=1S/C21H22Cl2N2O3/c1-14-3-4-16(11-15(14)2)21(27)25-9-7-24(8-10-25)20(26)13-28-19-6-5-17(22)12-18(19)23/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | IIQCSEAEITZSGJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |