C18H22Cl2N2O5 — CID 108568978
ethyl 4-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-4-oxobutanoate (PubChem CID 108568978) has the molecular formula C18H22Cl2N2O5 and a molecular weight of 417.29 g/mol. Its IUPAC name is ethyl 4-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 108568978 |
| Molecular Formula | C18H22Cl2N2O5 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | ethyl 4-[4-[2-(2,4-dichlorophenoxy)acetyl]piperazin-1-yl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCN(C(=O)COc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H22Cl2N2O5/c1-2-26-18(25)6-5-16(23)21-7-9-22(10-8-21)17(24)12-27-15-4-3-13(19)11-14(15)20/h3-4,11H,2,5-10,12H2,1H3 |
| InChIKey | VBCOCQRBLJBSJI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |