C17H18Cl2N3O2+ — CID 9228398
2-(2,4-dichlorophenoxy)-1-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethanone (PubChem CID 9228398) has the molecular formula C17H18Cl2N3O2+ and a molecular weight of 367.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 9228398 |
| Molecular Formula | C17H18Cl2N3O2+ |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-(4-pyridin-1-ium-4-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCN(c2cc[nH+]cc2)CC1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c18-13-1-2-16(15(19)11-13)24-12-17(23)22-9-7-21(8-10-22)14-3-5-20-6-4-14/h1-6,11H,7-10,12H2/p+1 |
| InChIKey | PMPFTFKCAPDWFB-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |