C19H17Cl3N2O3 — CID 39711810
1-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone (PubChem CID 39711810) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is 1-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone.
| Compound Name | 1-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 39711810 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 1-[4-(2-chlorobenzoyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H17Cl3N2O3/c20-13-5-6-17(16(22)11-13)27-12-18(25)23-7-9-24(10-8-23)19(26)14-3-1-2-4-15(14)21/h1-6,11H,7-10,12H2 |
| InChIKey | ASAOKRBVGXYQIA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |