C12H12Cl3NO2 — CID 977971
1-pyrrolidin-1-yl-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 977971) has the molecular formula C12H12Cl3NO2 and a molecular weight of 308.59 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-pyrrolidin-1-yl-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 977971 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 1-pyrrolidin-1-yl-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCCC1 |
| InChI | InChI=1S/C12H12Cl3NO2/c13-8-5-10(15)11(6-9(8)14)18-7-12(17)16-3-1-2-4-16/h5-6H,1-4,7H2 |
| InChIKey | UGYKGEDSRUCPII-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|