C15H18Cl3N3O3 — CID 78801280
N-methyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide (PubChem CID 78801280) has the molecular formula C15H18Cl3N3O3 and a molecular weight of 394.69 g/mol. Its IUPAC name is N-methyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-methyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 78801280 |
| Molecular Formula | C15H18Cl3N3O3 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-methyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide |
| SMILES | CNC(=O)CN1CCN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H18Cl3N3O3/c1-19-14(22)8-20-2-4-21(5-3-20)15(23)9-24-13-7-11(17)10(16)6-12(13)18/h6-7H,2-5,8-9H2,1H3,(H,19,22) |
| InChIKey | ZORYWROPWOEARY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|