C20H20Cl3N3O3 — CID 34432596
N-phenyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide (PubChem CID 34432596) has the molecular formula C20H20Cl3N3O3 and a molecular weight of 456.76 g/mol. Its IUPAC name is N-phenyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-phenyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 34432596 |
| Molecular Formula | C20H20Cl3N3O3 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-phenyl-2-[4-[2-(2,4,5-trichlorophenoxy)acetyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C20H20Cl3N3O3/c21-15-10-17(23)18(11-16(15)22)29-13-20(28)26-8-6-25(7-9-26)12-19(27)24-14-4-2-1-3-5-14/h1-5,10-11H,6-9,12-13H2,(H,24,27) |
| InChIKey | POIZHTZWNVQQRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|