C14H17Cl3N2O2 — CID 119563145
1-[4-(methylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 119563145) has the molecular formula C14H17Cl3N2O2 and a molecular weight of 351.66 g/mol. Its IUPAC name is 1-[4-(methylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-[4-(methylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 119563145 |
| Molecular Formula | C14H17Cl3N2O2 |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-[4-(methylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | CNC1CCN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl3N2O2/c1-18-9-2-4-19(5-3-9)14(20)8-21-13-7-11(16)10(15)6-12(13)17/h6-7,9,18H,2-5,8H2,1H3 |
| InChIKey | ZUZLEGMIJIBGHA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|