C17H22Cl4N2O2 — CID 119624635
1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride (PubChem CID 119624635) has the molecular formula C17H22Cl4N2O2 and a molecular weight of 428.19 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119624635 |
| Molecular Formula | C17H22Cl4N2O2 |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
| SMILES | Cl.O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C17H21Cl3N2O2.ClH/c18-13-7-15(20)16(8-14(13)19)24-10-17(23)22-5-3-12(4-6-22)21-9-11-1-2-11;/h7-8,11-12,21H,1-6,9-10H2;1H |
| InChIKey | QQCGMLOIZVDTBC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|