C16H22Cl4N2O3 — CID 119664033
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride (PubChem CID 119664033) has the molecular formula C16H22Cl4N2O3 and a molecular weight of 432.18 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119664033 |
| Molecular Formula | C16H22Cl4N2O3 |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl3N2O3.ClH/c17-12-8-14(19)15(9-13(12)18)24-10-16(22)21-5-2-11(3-6-21)23-7-1-4-20;/h8-9,11H,1-7,10,20H2;1H |
| InChIKey | QFZFGBYELWHSRP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|