C16H22Cl4N2O2 — CID 119647507
1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride (PubChem CID 119647507) has the molecular formula C16H22Cl4N2O2 and a molecular weight of 416.18 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119647507 |
| Molecular Formula | C16H22Cl4N2O2 |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CC1.Cl |
| InChI | InChI=1S/C16H21Cl3N2O2.ClH/c1-2-20-9-11-3-5-21(6-4-11)16(22)10-23-15-8-13(18)12(17)7-14(15)19;/h7-8,11,20H,2-6,9-10H2,1H3;1H |
| InChIKey | ZJUWWSCUYJPFFZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|