C15H19Cl3N2O2 — CID 119398073
1-[3-(methylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 119398073) has the molecular formula C15H19Cl3N2O2 and a molecular weight of 365.69 g/mol. Its IUPAC name is 1-[3-(methylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 119398073 |
| Molecular Formula | C15H19Cl3N2O2 |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | CNCC1CCCN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H19Cl3N2O2/c1-19-7-10-3-2-4-20(8-10)15(21)9-22-14-6-12(17)11(16)5-13(14)18/h5-6,10,19H,2-4,7-9H2,1H3 |
| InChIKey | UIJOKNDZHVFWAX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|