C15H14Cl3N3O2S — CID 18138931
1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 18138931) has the molecular formula C15H14Cl3N3O2S and a molecular weight of 406.72 g/mol. Its IUPAC name is 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 18138931 |
| Molecular Formula | C15H14Cl3N3O2S |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H14Cl3N3O2S/c16-10-7-12(18)13(8-11(10)17)23-9-14(22)20-2-4-21(5-3-20)15-19-1-6-24-15/h1,6-8H,2-5,9H2 |
| InChIKey | KTPWUTIEOMCLRI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|