C22H34N6O2S2 — CID 158048076
1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butan-1-one (PubChem CID 158048076) has the molecular formula C22H34N6O2S2 and a molecular weight of 478.69 g/mol. Its IUPAC name is 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 158048076 |
| Molecular Formula | C22H34N6O2S2 |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(c2nccs2)CC1.CCCC(=O)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/2C11H17N3OS/c2*1-2-3-10(15)13-5-7-14(8-6-13)11-12-4-9-16-11/h2*4,9H,2-3,5-8H2,1H3 |
| InChIKey | FJDPXIIGMAJOKE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |