C11H17N3O2S — CID 60708282
2-ethoxy-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 60708282) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-ethoxy-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-ethoxy-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 60708282 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-ethoxy-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | CCOCC(=O)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C11H17N3O2S/c1-2-16-9-10(15)13-4-6-14(7-5-13)11-12-3-8-17-11/h3,8H,2,4-7,9H2,1H3 |
| InChIKey | UZYAUSADIWAJPK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |