C18H22N4O3S — CID 18138965
2-ethoxy-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]benzamide (PubChem CID 18138965) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-ethoxy-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 18138965 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-ethoxy-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C18H22N4O3S/c1-2-25-15-6-4-3-5-14(15)17(24)20-13-16(23)21-8-10-22(11-9-21)18-19-7-12-26-18/h3-7,12H,2,8-11,13H2,1H3,(H,20,24) |
| InChIKey | IYPKRYRVYUDMLK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |