C20H28N2O3 — CID 136520005
2-ethoxy-N-[2-(9-methyl-6-azaspiro[3.5]nonan-6-yl)-2-oxoethyl]benzamide (PubChem CID 136520005) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-ethoxy-N-[2-(9-methyl-6-azaspiro[3.5]nonan-6-yl)-2-oxoethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-(9-methyl-6-azaspiro[3.5]nonan-6-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 136520005 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-ethoxy-N-[2-(9-methyl-6-azaspiro[3.5]nonan-6-yl)-2-oxoethyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)N1CCC(C)C2(CCC2)C1 |
| InChI | InChI=1S/C20H28N2O3/c1-3-25-17-8-5-4-7-16(17)19(24)21-13-18(23)22-12-9-15(2)20(14-22)10-6-11-20/h4-5,7-8,15H,3,6,9-14H2,1-2H3,(H,21,24) |
| InChIKey | REIJTBJSNCKNTL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |