C17H22N4O2S — CID 36871528
N-(2-ethoxyphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide (PubChem CID 36871528) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 36871528 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-23-15-6-4-3-5-14(15)19-16(22)13-20-8-10-21(11-9-20)17-18-7-12-24-17/h3-7,12H,2,8-11,13H2,1H3,(H,19,22) |
| InChIKey | TXYZZGNNPCBUIG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |