C17H20N4O2S — CID 17444873
N-(4-acetylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide (PubChem CID 17444873) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17444873 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(4-acetylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CN2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-13(22)14-2-4-15(5-3-14)19-16(23)12-20-7-9-21(10-8-20)17-18-6-11-24-17/h2-6,11H,7-10,12H2,1H3,(H,19,23) |
| InChIKey | RVVWSQKCKQVESF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |