C15H16Cl2N4OS — CID 18136524
N-(3,4-dichlorophenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide (PubChem CID 18136524) has the molecular formula C15H16Cl2N4OS and a molecular weight of 371.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18136524 |
| Molecular Formula | C15H16Cl2N4OS |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2nccs2)CC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N4OS/c16-12-2-1-11(9-13(12)17)19-14(22)10-20-4-6-21(7-5-20)15-18-3-8-23-15/h1-3,8-9H,4-7,10H2,(H,19,22) |
| InChIKey | UTUPOOZMYNFBFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |