C17H17Cl3N3O2+ — CID 7477295
1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 7477295) has the molecular formula C17H17Cl3N3O2+ and a molecular weight of 401.70 g/mol. Its IUPAC name is 1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 7477295 |
| Molecular Formula | C17H17Cl3N3O2+ |
| Molecular Weight | 401.70 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C17H16Cl3N3O2/c18-12-9-14(20)15(10-13(12)19)25-11-17(24)23-7-5-22(6-8-23)16-3-1-2-4-21-16/h1-4,9-10H,5-8,11H2/p+1 |
| InChIKey | GAXFRDJCIUIVPY-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|