C18H21N4O5+ — CID 9338003
2-(4-methoxy-2-nitrophenoxy)-1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethanone (PubChem CID 9338003) has the molecular formula C18H21N4O5+ and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-(4-methoxy-2-nitrophenoxy)-1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-methoxy-2-nitrophenoxy)-1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 9338003 |
| Molecular Formula | C18H21N4O5+ |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-(4-methoxy-2-nitrophenoxy)-1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc(OCC(=O)N2CCN(c3cccc[nH+]3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N4O5/c1-26-14-5-6-16(15(12-14)22(24)25)27-13-18(23)21-10-8-20(9-11-21)17-4-2-3-7-19-17/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | OBJKHKVPYBHMGQ-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 99.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|