C12H12N2O7 — CID 8880784
3-[2-(4-methoxy-2-nitrophenoxy)acetyl]-1,3-oxazolidin-2-one (PubChem CID 8880784) has the molecular formula C12H12N2O7 and a molecular weight of 296.24 g/mol. Its IUPAC name is 3-[2-(4-methoxy-2-nitrophenoxy)acetyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(4-methoxy-2-nitrophenoxy)acetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 8880784 |
| Molecular Formula | C12H12N2O7 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[2-(4-methoxy-2-nitrophenoxy)acetyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(OCC(=O)N2CCOC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N2O7/c1-19-8-2-3-10(9(6-8)14(17)18)21-7-11(15)13-4-5-20-12(13)16/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | XXZNAGIQTUPXHD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|